C15H19N3O3 — CID 165423803
N-phenyl-2-[(2S,5S)-2,4,5-trimethyl-3,6-dioxopiperazin-1-yl]acetamide (PubChem CID 165423803) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-phenyl-2-[(2S,5S)-2,4,5-trimethyl-3,6-dioxopiperazin-1-yl]acetamide.
| Compound Name | N-phenyl-2-[(2S,5S)-2,4,5-trimethyl-3,6-dioxopiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 165423803 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-phenyl-2-[(2S,5S)-2,4,5-trimethyl-3,6-dioxopiperazin-1-yl]acetamide |
| SMILES | C[C@H]1C(=O)N(CC(=O)Nc2ccccc2)[C@@H](C)C(=O)N1C |
| InChI | InChI=1S/C15H19N3O3/c1-10-15(21)18(11(2)14(20)17(10)3)9-13(19)16-12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3,(H,16,19)/t10-,11-/m0/s1 |
| InChIKey | GNQFQFHSNPGENK-QWRGUYRKSA-N |
| XLogP | 0.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |