C19H20F3NO3 — CID 165424536
1-[[4-methoxy-3-[3-(trifluoromethoxy)phenyl]phenyl]methyl]pyrrolidin-3-ol (PubChem CID 165424536) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is 1-[[4-methoxy-3-[3-(trifluoromethoxy)phenyl]phenyl]methyl]pyrrolidin-3-ol.
| Compound Name | 1-[[4-methoxy-3-[3-(trifluoromethoxy)phenyl]phenyl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 165424536 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-[[4-methoxy-3-[3-(trifluoromethoxy)phenyl]phenyl]methyl]pyrrolidin-3-ol |
| SMILES | COc1ccc(CN2CCC(O)C2)cc1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3NO3/c1-25-18-6-5-13(11-23-8-7-15(24)12-23)9-17(18)14-3-2-4-16(10-14)26-19(20,21)22/h2-6,9-10,15,24H,7-8,11-12H2,1H3 |
| InChIKey | NDVCKTUHEZBCOL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |