C23H35N3O2 — CID 165424834
1-ethyl-6-methyl-3-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]pyridin-2-one (PubChem CID 165424834) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 1-ethyl-6-methyl-3-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]pyridin-2-one.
| Compound Name | 1-ethyl-6-methyl-3-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]pyridin-2-one |
|---|---|
| PubChem CID | 165424834 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 1-ethyl-6-methyl-3-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]pyridin-2-one |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(C(=O)c3ccc(C)n(CC)c3=O)C2)[C@@H]2CCCCN21 |
| InChI | InChI=1S/C23H35N3O2/c1-4-8-20-17-13-18(21-9-6-7-12-26(20)21)15-24(14-17)22(27)19-11-10-16(3)25(5-2)23(19)28/h10-11,17-18,20-21H,4-9,12-15H2,1-3H3/t17-,18+,20-,21-/m0/s1 |
| InChIKey | COYJOHPMMMKVAB-YHELAOLJSA-N |
| XLogP | 3.29 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |