C18H24N4O4 — CID 165426907
5-[(3aS,6aS)-1-(oxane-4-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carbonyl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 165426907) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 5-[(3aS,6aS)-1-(oxane-4-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carbonyl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-[(3aS,6aS)-1-(oxane-4-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carbonyl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 165426907 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 5-[(3aS,6aS)-1-(oxane-4-carbonyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carbonyl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1ncc(C(=O)N2CC[C@H]3[C@@H]2CCN3C(=O)C2CCOCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H24N4O4/c1-11-19-10-13(16(23)20-11)18(25)22-7-3-14-15(22)2-6-21(14)17(24)12-4-8-26-9-5-12/h10,12,14-15H,2-9H2,1H3,(H,19,20,23)/t14-,15-/m0/s1 |
| InChIKey | QOCMAWGKVKPURS-GJZGRUSLSA-N |
| XLogP | 0.32 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |