C16H23N7O2 — CID 165427113
1-[(5S)-5-methyl-3-(oxan-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone (PubChem CID 165427113) has the molecular formula C16H23N7O2 and a molecular weight of 345.41 g/mol. Its IUPAC name is 1-[(5S)-5-methyl-3-(oxan-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone.
| Compound Name | 1-[(5S)-5-methyl-3-(oxan-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone |
|---|---|
| PubChem CID | 165427113 |
| Molecular Formula | C16H23N7O2 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[(5S)-5-methyl-3-(oxan-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone |
| SMILES | Cc1nc(CC(=O)N2Cc3nnc(C4CCOCC4)n3[C@@H](C)C2)n[nH]1 |
| InChI | InChI=1S/C16H23N7O2/c1-10-8-22(15(24)7-13-17-11(2)18-19-13)9-14-20-21-16(23(10)14)12-3-5-25-6-4-12/h10,12H,3-9H2,1-2H3,(H,17,18,19)/t10-/m0/s1 |
| InChIKey | BCPHZPXQHHWKBN-JTQLQIEISA-N |
| XLogP | 0.74 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |