C22H30FN3O3 — CID 165427380
(1R,16S)-6-fluoro-18-(3-methylbut-2-enyl)-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione (PubChem CID 165427380) has the molecular formula C22H30FN3O3 and a molecular weight of 403.50 g/mol. Its IUPAC name is (1R,16S)-6-fluoro-18-(3-methylbut-2-enyl)-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione.
| Compound Name | (1R,16S)-6-fluoro-18-(3-methylbut-2-enyl)-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione |
|---|---|
| PubChem CID | 165427380 |
| Molecular Formula | C22H30FN3O3 |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (1R,16S)-6-fluoro-18-(3-methylbut-2-enyl)-10-oxa-2,14,18-triazatricyclo[14.3.2.04,9]henicosa-4(9),5,7-triene-3,15-dione |
| SMILES | CC(C)=CCN1C[C@H]2CC[C@@H](C1)C(=O)NCCCOc1ccc(F)cc1C(=O)N2 |
| InChI | InChI=1S/C22H30FN3O3/c1-15(2)8-10-26-13-16-4-6-18(14-26)25-22(28)19-12-17(23)5-7-20(19)29-11-3-9-24-21(16)27/h5,7-8,12,16,18H,3-4,6,9-11,13-14H2,1-2H3,(H,24,27)(H,25,28)/t16-,18+/m0/s1 |
| InChIKey | JAMZPZTVJFOVSH-FUHWJXTLSA-N |
| XLogP | 2.50 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|