C16H22N6O3S — CID 165427905
N-[(1S,2S,4S)-4-[2-(4-ethyl-1,2,4-triazol-3-yl)ethylcarbamoyl]-2-hydroxycyclopentyl]-1,3-thiazole-4-carboxamide (PubChem CID 165427905) has the molecular formula C16H22N6O3S and a molecular weight of 378.46 g/mol. Its IUPAC name is N-[(1S,2S,4S)-4-[2-(4-ethyl-1,2,4-triazol-3-yl)ethylcarbamoyl]-2-hydroxycyclopentyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(1S,2S,4S)-4-[2-(4-ethyl-1,2,4-triazol-3-yl)ethylcarbamoyl]-2-hydroxycyclopentyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 165427905 |
| Molecular Formula | C16H22N6O3S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-[(1S,2S,4S)-4-[2-(4-ethyl-1,2,4-triazol-3-yl)ethylcarbamoyl]-2-hydroxycyclopentyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCn1cnnc1CCNC(=O)[C@H]1C[C@H](NC(=O)c2cscn2)[C@@H](O)C1 |
| InChI | InChI=1S/C16H22N6O3S/c1-2-22-8-19-21-14(22)3-4-17-15(24)10-5-11(13(23)6-10)20-16(25)12-7-26-9-18-12/h7-11,13,23H,2-6H2,1H3,(H,17,24)(H,20,25)/t10-,11-,13-/m0/s1 |
| InChIKey | QWVBLRVPWOFOIA-GVXVVHGQSA-N |
| XLogP | -0.02 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |