C20H28N2O2S2 — CID 165428077
1-[[4-(5-ethylsulfonylthiophen-2-yl)phenyl]methyl]-4-propan-2-ylpiperazine (PubChem CID 165428077) has the molecular formula C20H28N2O2S2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 1-[[4-(5-ethylsulfonylthiophen-2-yl)phenyl]methyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[[4-(5-ethylsulfonylthiophen-2-yl)phenyl]methyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 165428077 |
| Molecular Formula | C20H28N2O2S2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-[[4-(5-ethylsulfonylthiophen-2-yl)phenyl]methyl]-4-propan-2-ylpiperazine |
| SMILES | CCS(=O)(=O)c1ccc(-c2ccc(CN3CCN(C(C)C)CC3)cc2)s1 |
| InChI | InChI=1S/C20H28N2O2S2/c1-4-26(23,24)20-10-9-19(25-20)18-7-5-17(6-8-18)15-21-11-13-22(14-12-21)16(2)3/h5-10,16H,4,11-15H2,1-3H3 |
| InChIKey | GHDIYLQVUBFWDN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |