C24H28N2O4 — CID 165428270
5-[(3aS,6aR)-2-acetyl-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-4,6-dimethylpyran-2-one (PubChem CID 165428270) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 5-[(3aS,6aR)-2-acetyl-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-4,6-dimethylpyran-2-one.
| Compound Name | 5-[(3aS,6aR)-2-acetyl-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-4,6-dimethylpyran-2-one |
|---|---|
| PubChem CID | 165428270 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 5-[(3aS,6aR)-2-acetyl-3a-(2-phenylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-4,6-dimethylpyran-2-one |
| SMILES | CC(=O)N1C[C@@H]2CN(C(=O)c3c(C)cc(=O)oc3C)C[C@]2(CCc2ccccc2)C1 |
| InChI | InChI=1S/C24H28N2O4/c1-16-11-21(28)30-17(2)22(16)23(29)26-13-20-12-25(18(3)27)14-24(20,15-26)10-9-19-7-5-4-6-8-19/h4-8,11,20H,9-10,12-15H2,1-3H3/t20-,24+/m1/s1 |
| InChIKey | FUXUYIUWMCJACF-YKSBVNFPSA-N |
| XLogP | 2.81 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |