C18H18N8 — CID 165428599
2-[3-[1-[2-(4-methyltriazol-1-yl)ethyl]imidazol-2-yl]phenyl]pyrimidin-4-amine (PubChem CID 165428599) has the molecular formula C18H18N8 and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-[3-[1-[2-(4-methyltriazol-1-yl)ethyl]imidazol-2-yl]phenyl]pyrimidin-4-amine.
| Compound Name | 2-[3-[1-[2-(4-methyltriazol-1-yl)ethyl]imidazol-2-yl]phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 165428599 |
| Molecular Formula | C18H18N8 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-[3-[1-[2-(4-methyltriazol-1-yl)ethyl]imidazol-2-yl]phenyl]pyrimidin-4-amine |
| SMILES | Cc1cn(CCn2ccnc2-c2cccc(-c3nccc(N)n3)c2)nn1 |
| InChI | InChI=1S/C18H18N8/c1-13-12-26(24-23-13)10-9-25-8-7-21-18(25)15-4-2-3-14(11-15)17-20-6-5-16(19)22-17/h2-8,11-12H,9-10H2,1H3,(H2,19,20,22) |
| InChIKey | BEGHJTGGAHPKLX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |