C20H27N3O3S — CID 165428888
1-[(4aR,8aR)-4a-(hydroxymethyl)-1-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]ethanone (PubChem CID 165428888) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-[(4aR,8aR)-4a-(hydroxymethyl)-1-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]ethanone.
| Compound Name | 1-[(4aR,8aR)-4a-(hydroxymethyl)-1-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]ethanone |
|---|---|
| PubChem CID | 165428888 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 1-[(4aR,8aR)-4a-(hydroxymethyl)-1-[(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]ethanone |
| SMILES | CC(=O)N1CC[C@]2(CO)CCCN(Cc3nc(-c4cccs4)oc3C)[C@H]2C1 |
| InChI | InChI=1S/C20H27N3O3S/c1-14-16(21-19(26-14)17-5-3-10-27-17)11-23-8-4-6-20(13-24)7-9-22(15(2)25)12-18(20)23/h3,5,10,18,24H,4,6-9,11-13H2,1-2H3/t18-,20-/m0/s1 |
| InChIKey | YHKHFJITEMHAKZ-ICSRJNTNSA-N |
| XLogP | 2.91 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |