C15H18ClF2N5O6 — CID 165429018
(3R,4R,5S,6S)-6-[[2-chloro-9-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-5-fluorooxane-3,4-diol (PubChem CID 165429018) has the molecular formula C15H18ClF2N5O6 and a molecular weight of 437.79 g/mol. Its IUPAC name is (3R,4R,5S,6S)-6-[[2-chloro-9-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-5-fluorooxane-3,4-diol.
| Compound Name | (3R,4R,5S,6S)-6-[[2-chloro-9-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-5-fluorooxane-3,4-diol |
|---|---|
| PubChem CID | 165429018 |
| Molecular Formula | C15H18ClF2N5O6 |
| Molecular Weight | 437.79 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | (3R,4R,5S,6S)-6-[[2-chloro-9-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-5-fluorooxane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(N[C@H]4OC[C@@H](O)[C@@H](O)[C@@H]4F)nc(Cl)nc32)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C15H18ClF2N5O6/c16-15-21-11(20-13-6(17)9(26)4(25)2-28-13)8-12(22-15)23(3-19-8)14-7(18)10(27)5(1-24)29-14/h3-7,9-10,13-14,24-27H,1-2H2,(H,20,21,22)/t4-,5-,6+,7+,9-,10-,13+,14-/m1/s1 |
| InChIKey | CVGMTEFTBUZFCO-FBTYYZOESA-N |
| XLogP | -1.10 |
| TPSA | 155.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.79 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |