About 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride
3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride (PubChem CID 165429599) has the molecular formula C9H19ClN2O
and a molecular weight of 206.72 g/mol. Its IUPAC name is 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride |
| PubChem CID | 165429599 |
| Molecular Formula | C9H19ClN2O |
| Molecular Weight | 206.72 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride |
| SMILES | CCN(CC)C(=O)C1CC(N)C1.Cl |
| InChI | InChI=1S/C9H18N2O.ClH/c1-3-11(4-2)9(12)7-5-8(10)6-7;/h7-8H,3-6,10H2,1-2H3;1H |
| InChIKey | DIAYUAVSNAANNE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.72 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride?
The IUPAC name of 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride (CID 165429599) is 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride.
What is the SMILES notation for 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride?
The canonical SMILES for 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride is CCN(CC)C(=O)C1CC(N)C1.Cl.
What is the InChIKey of 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride?
The InChIKey is DIAYUAVSNAANNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.ClH/c1-3-11(4-2)9(12)7-5-8(10)6-7;/h7-8H,3-6,10H2,1-2H3;1H.
What are the key properties of 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride?
3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride has a molecular weight of 206.72 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-diethylcyclobutane-1-carboxamide;hydrochloride is sourced from PubChem (CID 165429599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).