About (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate
(2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate (PubChem CID 165430026) has the molecular formula C14H22O6
and a molecular weight of 286.32 g/mol. Its IUPAC name is (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate.
Molecular Properties
| Compound Name | (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate |
| PubChem CID | 165430026 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate |
| SMILES | CC(C)(O)COC(C)(C)CC(=O)OC1C(=O)CCC1=O |
| InChI | InChI=1S/C14H22O6/c1-13(2,18)8-19-14(3,4)7-11(17)20-12-9(15)5-6-10(12)16/h12,18H,5-8H2,1-4H3 |
| InChIKey | SNAMFEFLSQOVMW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate?
The IUPAC name of (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate (CID 165430026) is (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate.
What is the SMILES notation for (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate?
The canonical SMILES for (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate is CC(C)(O)COC(C)(C)CC(=O)OC1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate?
The InChIKey is SNAMFEFLSQOVMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O6/c1-13(2,18)8-19-14(3,4)7-11(17)20-12-9(15)5-6-10(12)16/h12,18H,5-8H2,1-4H3.
What are the key properties of (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate?
(2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate has a molecular weight of 286.32 g/mol, XLogP of 0.79, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxocyclopentyl) 3-(2-hydroxy-2-methylpropoxy)-3-methylbutanoate is sourced from PubChem (CID 165430026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).