C14H25NO9 — CID 165430161
(7R,8S)-3-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol (PubChem CID 165430161) has the molecular formula C14H25NO9 and a molecular weight of 351.35 g/mol. Its IUPAC name is (7R,8S)-3-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol.
| Compound Name | (7R,8S)-3-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol |
|---|---|
| PubChem CID | 165430161 |
| Molecular Formula | C14H25NO9 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (7R,8S)-3-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-methoxyoxan-2-yl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol |
| SMILES | CO[C@@]1(C2C(O)C(O)[C@@H]3[C@H](O)CCN23)O[C@H](CO)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H25NO9/c1-23-14(13(22)11(21)8(18)6(4-16)24-14)12-10(20)9(19)7-5(17)2-3-15(7)12/h5-13,16-22H,2-4H2,1H3/t5-,6-,7+,8-,9?,10?,11-,12?,13+,14+/m1/s1 |
| InChIKey | YVLGLOPAOKYXFA-HTFNIYFWSA-N |
| XLogP | -4.66 |
| TPSA | 163.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | -4.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |