C18H30N2O6 — CID 165430162
[(1S,5S,6R,7R,8R)-6,7-diacetyloxy-5-(diethylamino)-3-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate (PubChem CID 165430162) has the molecular formula C18H30N2O6 and a molecular weight of 370.45 g/mol. Its IUPAC name is [(1S,5S,6R,7R,8R)-6,7-diacetyloxy-5-(diethylamino)-3-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate.
| Compound Name | [(1S,5S,6R,7R,8R)-6,7-diacetyloxy-5-(diethylamino)-3-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate |
|---|---|
| PubChem CID | 165430162 |
| Molecular Formula | C18H30N2O6 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [(1S,5S,6R,7R,8R)-6,7-diacetyloxy-5-(diethylamino)-3-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate |
| SMILES | CCN(CC)[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2[C@@H](OC(C)=O)CC(C)N21 |
| InChI | InChI=1S/C18H30N2O6/c1-7-19(8-2)18-17(26-13(6)23)16(25-12(5)22)15-14(24-11(4)21)9-10(3)20(15)18/h10,14-18H,7-9H2,1-6H3/t10?,14-,15+,16+,17-,18-/m0/s1 |
| InChIKey | HZAINNKOKMOIMP-YABRYVHUSA-N |
| XLogP | 0.93 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|