C15H7Cl4N3O5S — CID 165430324
4-sulfamoyl-N-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 165430324) has the molecular formula C15H7Cl4N3O5S and a molecular weight of 483.12 g/mol. Its IUPAC name is 4-sulfamoyl-N-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | 4-sulfamoyl-N-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 165430324 |
| Molecular Formula | C15H7Cl4N3O5S |
| Molecular Weight | 483.12 g/mol |
| Exact Mass | 480.89 |
| IUPAC Name | 4-sulfamoyl-N-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NN2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)cc1 |
| InChI | InChI=1S/C15H7Cl4N3O5S/c16-9-7-8(10(17)12(19)11(9)18)15(25)22(14(7)24)21-13(23)5-1-3-6(4-2-5)28(20,26)27/h1-4H,(H,21,23)(H2,20,26,27) |
| InChIKey | DKGSEOGCJUDPKK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.12 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|