About N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide
N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide (PubChem CID 165430363) has the molecular formula C15H9Cl2N3O5S
and a molecular weight of 414.23 g/mol. Its IUPAC name is N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide.
Molecular Properties
| Compound Name | N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide |
| PubChem CID | 165430363 |
| Molecular Formula | C15H9Cl2N3O5S |
| Molecular Weight | 414.23 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)cc1 |
| InChI | InChI=1S/C15H9Cl2N3O5S/c16-11-5-9-10(6-12(11)17)15(23)20(14(9)22)19-13(21)7-1-3-8(4-2-7)26(18,24)25/h1-6H,(H,19,21)(H2,18,24,25) |
| InChIKey | ZISBSVOWWSSQFO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide?
The IUPAC name of N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide (CID 165430363) is N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide.
What is the SMILES notation for N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide?
The canonical SMILES for N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide is NS(=O)(=O)c1ccc(C(=O)NN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)cc1.
What is the InChIKey of N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide?
The InChIKey is ZISBSVOWWSSQFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Cl2N3O5S/c16-11-5-9-10(6-12(11)17)15(23)20(14(9)22)19-13(21)7-1-3-8(4-2-7)26(18,24)25/h1-6H,(H,19,21)(H2,18,24,25).
What are the key properties of N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide?
N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide has a molecular weight of 414.23 g/mol, XLogP of 1.58, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-sulfamoylbenzamide is sourced from PubChem (CID 165430363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).