C33H41NO7 — CID 165430404
[(1S,4E,6R,10R,12E,14S,15S,17S,18S,19S)-15-acetyloxy-19-benzyl-10,17-dimethyl-16-methylidene-3,21-dioxo-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-4,12-dien-6-yl] acetate (PubChem CID 165430404) has the molecular formula C33H41NO7 and a molecular weight of 563.69 g/mol. Its IUPAC name is [(1S,4E,6R,10R,12E,14S,15S,17S,18S,19S)-15-acetyloxy-19-benzyl-10,17-dimethyl-16-methylidene-3,21-dioxo-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-4,12-dien-6-yl] acetate.
| Compound Name | [(1S,4E,6R,10R,12E,14S,15S,17S,18S,19S)-15-acetyloxy-19-benzyl-10,17-dimethyl-16-methylidene-3,21-dioxo-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-4,12-dien-6-yl] acetate |
|---|---|
| PubChem CID | 165430404 |
| Molecular Formula | C33H41NO7 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | [(1S,4E,6R,10R,12E,14S,15S,17S,18S,19S)-15-acetyloxy-19-benzyl-10,17-dimethyl-16-methylidene-3,21-dioxo-2-oxa-20-azatricyclo[12.7.0.01,18]henicosa-4,12-dien-6-yl] acetate |
| SMILES | C=C1[C@@H](C)[C@H]2[C@H](Cc3ccccc3)NC(=O)[C@]23OC(=O)/C=C/[C@H](OC(C)=O)CCC[C@@H](C)C/C=C/[C@H]3[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H41NO7/c1-20-11-9-15-26(39-23(4)35)17-18-29(37)41-33-27(16-10-12-20)31(40-24(5)36)22(3)21(2)30(33)28(34-32(33)38)19-25-13-7-6-8-14-25/h6-8,10,13-14,16-18,20-21,26-28,30-31H,3,9,11-12,15,19H2,1-2,4-5H3,(H,34,38)/b16-10+,18-17+/t20-,21-,26-,27+,28+,30+,31-,33-/m1/s1 |
| InChIKey | YQSPNPOQAUTCOF-CPVBRIGKSA-N |
| XLogP | 4.63 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|