C31H33N9O8 — CID 165430646
(2S)-2-[[(2S)-2-[[2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]-5-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 165430646) has the molecular formula C31H33N9O8 and a molecular weight of 659.66 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]-5-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]-5-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 165430646 |
| Molecular Formula | C31H33N9O8 |
| Molecular Weight | 659.66 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[(2-amino-4-oxo-3H-pteridine-7-carbonyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]-5-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | Nc1nc2nc(C(=O)NCC(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@@H](CCCNC(=O)OCc3ccccc3)C(=O)O)cnc2c(=O)[nH]1 |
| InChI | InChI=1S/C31H33N9O8/c32-30-39-25-24(28(44)40-30)34-15-22(37-25)26(42)35-16-23(41)36-21(14-18-8-3-1-4-9-18)27(43)38-20(29(45)46)12-7-13-33-31(47)48-17-19-10-5-2-6-11-19/h1-6,8-11,15,20-21H,7,12-14,16-17H2,(H,33,47)(H,35,42)(H,36,41)(H,38,43)(H,45,46)(H3,32,37,39,40,44)/t20-,21-/m0/s1 |
| InChIKey | QOJLCYQYXRRJPT-SFTDATJTSA-N |
| XLogP | 0.03 |
| TPSA | 260.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.66 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|