C21H22ClN3O5 — CID 165430654
5-chloro-20-methoxy-9,12,15,18-tetraoxa-2,23,25-triazatetracyclo[17.6.2.03,8.022,26]heptacosa-1(25),3(8),4,6,19,21,23,26-octaene (PubChem CID 165430654) has the molecular formula C21H22ClN3O5 and a molecular weight of 431.88 g/mol. Its IUPAC name is 5-chloro-20-methoxy-9,12,15,18-tetraoxa-2,23,25-triazatetracyclo[17.6.2.03,8.022,26]heptacosa-1(25),3(8),4,6,19,21,23,26-octaene.
| Compound Name | 5-chloro-20-methoxy-9,12,15,18-tetraoxa-2,23,25-triazatetracyclo[17.6.2.03,8.022,26]heptacosa-1(25),3(8),4,6,19,21,23,26-octaene |
|---|---|
| PubChem CID | 165430654 |
| Molecular Formula | C21H22ClN3O5 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 5-chloro-20-methoxy-9,12,15,18-tetraoxa-2,23,25-triazatetracyclo[17.6.2.03,8.022,26]heptacosa-1(25),3(8),4,6,19,21,23,26-octaene |
| SMILES | COc1cc2ncnc3c2cc1OCCOCCOCCOc1ccc(Cl)cc1N3 |
| InChI | InChI=1S/C21H22ClN3O5/c1-26-19-12-16-15-11-20(19)30-9-7-28-5-4-27-6-8-29-18-3-2-14(22)10-17(18)25-21(15)24-13-23-16/h2-3,10-13H,4-9H2,1H3,(H,23,24,25) |
| InChIKey | OPYKRPJXSJBBEP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |