C28H39CoN3O5 — CID 165430868
4-tert-butyl-2-[[(1R,2R)-2-[(5-tert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol;cobalt;nitric acid (PubChem CID 165430868) has the molecular formula C28H39CoN3O5 and a molecular weight of 556.57 g/mol. Its IUPAC name is 4-tert-butyl-2-[[(1R,2R)-2-[(5-tert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol;cobalt;nitric acid.
| Compound Name | 4-tert-butyl-2-[[(1R,2R)-2-[(5-tert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol;cobalt;nitric acid |
|---|---|
| PubChem CID | 165430868 |
| Molecular Formula | C28H39CoN3O5 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 4-tert-butyl-2-[[(1R,2R)-2-[(5-tert-butyl-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol;cobalt;nitric acid |
| SMILES | CC(C)(C)c1ccc(O)c(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cc(C(C)(C)C)ccc2O)c1.O=[N+]([O-])O.[Co] |
| InChI | InChI=1S/C28H38N2O2.Co.HNO3/c1-27(2,3)21-11-13-25(31)19(15-21)17-29-23-9-7-8-10-24(23)30-18-20-16-22(28(4,5)6)12-14-26(20)32;;2-1(3)4/h11-18,23-24,31-32H,7-10H2,1-6H3;;(H,2,3,4)/b29-17+,30-18+;;/t23-,24-;;/m1../s1 |
| InChIKey | QDAVZJULNKQHOE-XKTFVHPZSA-N |
| XLogP | 6.19 |
| TPSA | 128.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|