C11H13F2N3O — CID 165431443
[6-(difluoromethyl)-2-methylpyrimidin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 165431443) has the molecular formula C11H13F2N3O and a molecular weight of 241.24 g/mol. Its IUPAC name is [6-(difluoromethyl)-2-methylpyrimidin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [6-(difluoromethyl)-2-methylpyrimidin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 165431443 |
| Molecular Formula | C11H13F2N3O |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | [6-(difluoromethyl)-2-methylpyrimidin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1nc(C(=O)N2CCCC2)cc(C(F)F)n1 |
| InChI | InChI=1S/C11H13F2N3O/c1-7-14-8(10(12)13)6-9(15-7)11(17)16-4-2-3-5-16/h6,10H,2-5H2,1H3 |
| InChIKey | ZXQIIAFPBNEJMZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |