About 8-(azepan-1-yl)imidazo[1,2-a]pyrazine
8-(azepan-1-yl)imidazo[1,2-a]pyrazine (PubChem CID 165431553) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is 8-(azepan-1-yl)imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 8-(azepan-1-yl)imidazo[1,2-a]pyrazine |
| PubChem CID | 165431553 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 8-(azepan-1-yl)imidazo[1,2-a]pyrazine |
| SMILES | c1cn2ccnc2c(N2CCCCCC2)n1 |
| InChI | InChI=1S/C12H16N4/c1-2-4-8-15(7-3-1)11-12-14-6-10-16(12)9-5-13-11/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | RMWCTRJBLQLLLK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(azepan-1-yl)imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(azepan-1-yl)imidazo[1,2-a]pyrazine?
The IUPAC name of 8-(azepan-1-yl)imidazo[1,2-a]pyrazine (CID 165431553) is 8-(azepan-1-yl)imidazo[1,2-a]pyrazine.
What is the SMILES notation for 8-(azepan-1-yl)imidazo[1,2-a]pyrazine?
The canonical SMILES for 8-(azepan-1-yl)imidazo[1,2-a]pyrazine is c1cn2ccnc2c(N2CCCCCC2)n1.
What is the InChIKey of 8-(azepan-1-yl)imidazo[1,2-a]pyrazine?
The InChIKey is RMWCTRJBLQLLLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c1-2-4-8-15(7-3-1)11-12-14-6-10-16(12)9-5-13-11/h5-6,9-10H,1-4,7-8H2.
What are the key properties of 8-(azepan-1-yl)imidazo[1,2-a]pyrazine?
8-(azepan-1-yl)imidazo[1,2-a]pyrazine has a molecular weight of 216.29 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(azepan-1-yl)imidazo[1,2-a]pyrazine is sourced from PubChem (CID 165431553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).