C14H21FN4OS — CID 165431976
N-[[4-fluoro-1-(6-methyl-2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]methyl]acetamide (PubChem CID 165431976) has the molecular formula C14H21FN4OS and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[[4-fluoro-1-(6-methyl-2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]methyl]acetamide.
| Compound Name | N-[[4-fluoro-1-(6-methyl-2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 165431976 |
| Molecular Formula | C14H21FN4OS |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-[[4-fluoro-1-(6-methyl-2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]methyl]acetamide |
| SMILES | CSc1nc(C)cc(N2CCC(F)(CNC(C)=O)CC2)n1 |
| InChI | InChI=1S/C14H21FN4OS/c1-10-8-12(18-13(17-10)21-3)19-6-4-14(15,5-7-19)9-16-11(2)20/h8H,4-7,9H2,1-3H3,(H,16,20) |
| InChIKey | IZNLGZGZWYSISB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |