About N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide
N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide (PubChem CID 165433268) has the molecular formula C13H20N6O2S
and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide |
| PubChem CID | 165433268 |
| Molecular Formula | C13H20N6O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide |
| SMILES | Cc1nc(N2CCC(NS(C)(=O)=O)CC2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C13H20N6O2S/c1-9-15-12-11(8-14-18(12)2)13(16-9)19-6-4-10(5-7-19)17-22(3,20)21/h8,10,17H,4-7H2,1-3H3 |
| InChIKey | CZURJPUAIFVFJE-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide?
The IUPAC name of N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide (CID 165433268) is N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide.
What is the SMILES notation for N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide?
The canonical SMILES for N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide is Cc1nc(N2CCC(NS(C)(=O)=O)CC2)c2cnn(C)c2n1.
What is the InChIKey of N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide?
The InChIKey is CZURJPUAIFVFJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6O2S/c1-9-15-12-11(8-14-18(12)2)13(16-9)19-6-4-10(5-7-19)17-22(3,20)21/h8,10,17H,4-7H2,1-3H3.
What are the key properties of N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide?
N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide has a molecular weight of 324.41 g/mol, XLogP of 0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-yl)piperidin-4-yl]methanesulfonamide is sourced from PubChem (CID 165433268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).