About N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine
N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 165433302) has the molecular formula C15H20N2O3S
and a molecular weight of 308.40 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine |
| PubChem CID | 165433302 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CCOc1cccc2sc(N(C)CC3COCCO3)nc12 |
| InChI | InChI=1S/C15H20N2O3S/c1-3-19-12-5-4-6-13-14(12)16-15(21-13)17(2)9-11-10-18-7-8-20-11/h4-6,11H,3,7-10H2,1-2H3 |
| InChIKey | FLQGQCWRXULEID-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine?
The IUPAC name of N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine (CID 165433302) is N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine?
The canonical SMILES for N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine is CCOc1cccc2sc(N(C)CC3COCCO3)nc12.
What is the InChIKey of N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine?
The InChIKey is FLQGQCWRXULEID-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3S/c1-3-19-12-5-4-6-13-14(12)16-15(21-13)17(2)9-11-10-18-7-8-20-11/h4-6,11H,3,7-10H2,1-2H3.
What are the key properties of N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine?
N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine has a molecular weight of 308.40 g/mol, XLogP of 2.55, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dioxan-2-ylmethyl)-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 165433302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).