About 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine
8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine (PubChem CID 165433657) has the molecular formula C17H14F5N5
and a molecular weight of 383.32 g/mol. Its IUPAC name is 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine |
| PubChem CID | 165433657 |
| Molecular Formula | C17H14F5N5 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine |
| SMILES | Fc1ccc(N2CCN(c3nccn4cc(C(F)(F)F)nc34)CC2)c(F)c1 |
| InChI | InChI=1S/C17H14F5N5/c18-11-1-2-13(12(19)9-11)25-5-7-26(8-6-25)15-16-24-14(17(20,21)22)10-27(16)4-3-23-15/h1-4,9-10H,5-8H2 |
| InChIKey | ANDDLOOVPDAJAS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine?
The IUPAC name of 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine (CID 165433657) is 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine.
What is the SMILES notation for 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine?
The canonical SMILES for 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine is Fc1ccc(N2CCN(c3nccn4cc(C(F)(F)F)nc34)CC2)c(F)c1.
What is the InChIKey of 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine?
The InChIKey is ANDDLOOVPDAJAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F5N5/c18-11-1-2-13(12(19)9-11)25-5-7-26(8-6-25)15-16-24-14(17(20,21)22)10-27(16)4-3-23-15/h1-4,9-10H,5-8H2.
What are the key properties of 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine?
8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine has a molecular weight of 383.32 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazine is sourced from PubChem (CID 165433657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).