C17H22FN3O2S — CID 165434141
N-(4-fluorophenyl)-2-[3-(thiomorpholine-4-carbonyl)pyrrolidin-1-yl]acetamide (PubChem CID 165434141) has the molecular formula C17H22FN3O2S and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[3-(thiomorpholine-4-carbonyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[3-(thiomorpholine-4-carbonyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 165434141 |
| Molecular Formula | C17H22FN3O2S |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-(4-fluorophenyl)-2-[3-(thiomorpholine-4-carbonyl)pyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(C(=O)N2CCSCC2)C1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FN3O2S/c18-14-1-3-15(4-2-14)19-16(22)12-20-6-5-13(11-20)17(23)21-7-9-24-10-8-21/h1-4,13H,5-12H2,(H,19,22) |
| InChIKey | JPRQYHMVWJXXPJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |