About (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone
(1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone (PubChem CID 165435156) has the molecular formula C15H19N5OS
and a molecular weight of 317.42 g/mol. Its IUPAC name is (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone.
Molecular Properties
| Compound Name | (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone |
| PubChem CID | 165435156 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone |
| SMILES | O=C(C1CCN(c2nccn3nccc23)C1)N1CCSCC1 |
| InChI | InChI=1S/C15H19N5OS/c21-15(18-7-9-22-10-8-18)12-2-5-19(11-12)14-13-1-3-17-20(13)6-4-16-14/h1,3-4,6,12H,2,5,7-11H2 |
| InChIKey | YIYIZQVHFXFMHV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone?
The IUPAC name of (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone (CID 165435156) is (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone.
What is the SMILES notation for (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone?
The canonical SMILES for (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone is O=C(C1CCN(c2nccn3nccc23)C1)N1CCSCC1.
What is the InChIKey of (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone?
The InChIKey is YIYIZQVHFXFMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5OS/c21-15(18-7-9-22-10-8-18)12-2-5-19(11-12)14-13-1-3-17-20(13)6-4-16-14/h1,3-4,6,12H,2,5,7-11H2.
What are the key properties of (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone?
(1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone has a molecular weight of 317.42 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-pyrazolo[1,5-a]pyrazin-4-ylpyrrolidin-3-yl)-thiomorpholin-4-ylmethanone is sourced from PubChem (CID 165435156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).