About 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane
1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane (PubChem CID 165435361) has the molecular formula C12H20N4O2S
and a molecular weight of 284.38 g/mol. Its IUPAC name is 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane |
| PubChem CID | 165435361 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane |
| SMILES | Cc1cnc(C)c(N2CCCN(S(C)(=O)=O)CC2)n1 |
| InChI | InChI=1S/C12H20N4O2S/c1-10-9-13-11(2)12(14-10)15-5-4-6-16(8-7-15)19(3,17)18/h9H,4-8H2,1-3H3 |
| InChIKey | LTKYQIOMEUUFFT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane?
The IUPAC name of 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane (CID 165435361) is 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane.
What is the SMILES notation for 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane?
The canonical SMILES for 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane is Cc1cnc(C)c(N2CCCN(S(C)(=O)=O)CC2)n1.
What is the InChIKey of 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane?
The InChIKey is LTKYQIOMEUUFFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O2S/c1-10-9-13-11(2)12(14-10)15-5-4-6-16(8-7-15)19(3,17)18/h9H,4-8H2,1-3H3.
What are the key properties of 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane?
1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane has a molecular weight of 284.38 g/mol, XLogP of 0.57, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dimethylpyrazin-2-yl)-4-methylsulfonyl-1,4-diazepane is sourced from PubChem (CID 165435361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).