About N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride
N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride (PubChem CID 165436162) has the molecular formula C17H23ClF2N2O
and a molecular weight of 344.83 g/mol. Its IUPAC name is N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride.
Molecular Properties
| Compound Name | N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride |
| PubChem CID | 165436162 |
| Molecular Formula | C17H23ClF2N2O |
| Molecular Weight | 344.83 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NC2CC(F)(F)C2)cc(C2CCNCC2)c1.Cl |
| InChI | InChI=1S/C17H22F2N2O.ClH/c1-11-6-13(12-2-4-20-5-3-12)8-14(7-11)16(22)21-15-9-17(18,19)10-15;/h6-8,12,15,20H,2-5,9-10H2,1H3,(H,21,22);1H |
| InChIKey | CMOBPCIHRKNXSY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.83 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride?
The IUPAC name of N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride (CID 165436162) is N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride.
What is the SMILES notation for N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride?
The canonical SMILES for N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride is Cc1cc(C(=O)NC2CC(F)(F)C2)cc(C2CCNCC2)c1.Cl.
What is the InChIKey of N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride?
The InChIKey is CMOBPCIHRKNXSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F2N2O.ClH/c1-11-6-13(12-2-4-20-5-3-12)8-14(7-11)16(22)21-15-9-17(18,19)10-15;/h6-8,12,15,20H,2-5,9-10H2,1H3,(H,21,22);1H.
What are the key properties of N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride?
N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride has a molecular weight of 344.83 g/mol, XLogP of 3.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluorocyclobutyl)-3-methyl-5-piperidin-4-ylbenzamide;hydrochloride is sourced from PubChem (CID 165436162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).