C22H22N6O3 — CID 165437189
N-[4-[(3R)-3-[(7-oxo-4a,8-dihydropyrido[2,3-d]pyrimidin-2-ylidene)amino]piperidine-1-carbonyl]phenyl]prop-2-enamide (PubChem CID 165437189) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is N-[4-[(3R)-3-[(7-oxo-4a,8-dihydropyrido[2,3-d]pyrimidin-2-ylidene)amino]piperidine-1-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[(3R)-3-[(7-oxo-4a,8-dihydropyrido[2,3-d]pyrimidin-2-ylidene)amino]piperidine-1-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 165437189 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-[4-[(3R)-3-[(7-oxo-4a,8-dihydropyrido[2,3-d]pyrimidin-2-ylidene)amino]piperidine-1-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)N2CCC[C@@H](/N=C3\N=CC4C=CC(=O)NC4=N3)C2)cc1 |
| InChI | InChI=1S/C22H22N6O3/c1-2-18(29)24-16-8-5-14(6-9-16)21(31)28-11-3-4-17(13-28)25-22-23-12-15-7-10-19(30)26-20(15)27-22/h2,5-10,12,15,17H,1,3-4,11,13H2,(H,24,29)(H,25,26,27,30)/t15?,17-/m1/s1 |
| InChIKey | UOYNDZXEBSSMDS-OMOCHNIRSA-N |
| XLogP | 1.56 |
| TPSA | 115.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|