C20H9FN2O3 — CID 165437402
7-fluoro-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 165437402) has the molecular formula C20H9FN2O3 and a molecular weight of 344.30 g/mol. Its IUPAC name is 7-fluoro-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 7-fluoro-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 165437402 |
| Molecular Formula | C20H9FN2O3 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 7-fluoro-3-oxa-13,23-diazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3ccccc3[nH]c1c1oc3ccc(F)cc3c21 |
| InChI | InChI=1S/C20H9FN2O3/c21-8-5-6-12-10(7-8)14-16-15(19(24)23-20(16)25)13-9-3-1-2-4-11(9)22-17(13)18(14)26-12/h1-7,22H,(H,23,24,25) |
| InChIKey | SCYLYTGUNATGKF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|