C10H21ClN2O2 — CID 165437684
4-(aminomethyl)-N-(2-hydroxyethyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 165437684) has the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-hydroxyethyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-(2-hydroxyethyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 165437684 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-(aminomethyl)-N-(2-hydroxyethyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NCC1CCC(C(=O)NCCO)CC1 |
| InChI | InChI=1S/C10H20N2O2.ClH/c11-7-8-1-3-9(4-2-8)10(14)12-5-6-13;/h8-9,13H,1-7,11H2,(H,12,14);1H |
| InChIKey | GBMYVHJBRFTRIL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |