C27H15F12N3O2 — CID 165437849
(4R)-4-[3,5-bis(trifluoromethyl)phenyl]-2-[6-[(4R)-4-[3,5-bis(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole (PubChem CID 165437849) has the molecular formula C27H15F12N3O2 and a molecular weight of 641.41 g/mol. Its IUPAC name is (4R)-4-[3,5-bis(trifluoromethyl)phenyl]-2-[6-[(4R)-4-[3,5-bis(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-4-[3,5-bis(trifluoromethyl)phenyl]-2-[6-[(4R)-4-[3,5-bis(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 165437849 |
| Molecular Formula | C27H15F12N3O2 |
| Molecular Weight | 641.41 g/mol |
| Exact Mass | 641.10 |
| IUPAC Name | (4R)-4-[3,5-bis(trifluoromethyl)phenyl]-2-[6-[(4R)-4-[3,5-bis(trifluoromethyl)phenyl]-4,5-dihydro-1,3-oxazol-2-yl]-2-pyridinyl]-4,5-dihydro-1,3-oxazole |
| SMILES | FC(F)(F)c1cc([C@@H]2COC(c3cccc(C4=N[C@H](c5cc(C(F)(F)F)cc(C(F)(F)F)c5)CO4)n3)=N2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H15F12N3O2/c28-24(29,30)14-4-12(5-15(8-14)25(31,32)33)20-10-43-22(41-20)18-2-1-3-19(40-18)23-42-21(11-44-23)13-6-16(26(34,35)36)9-17(7-13)27(37,38)39/h1-9,20-21H,10-11H2/t20-,21-/m0/s1 |
| InChIKey | LLRPZYCUCDKGKW-SFTDATJTSA-N |
| XLogP | 8.19 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.41 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |