N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride

C6H5Cl2N3O — CID 165437940

IUPACN-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride
SMILESCN(C(=O)Cl)c1ncc(Cl)cn1
InChIInChI=1S/C6H5Cl2N3O/c1-11(5(8)12)6-9-2-4(7)3-10-6/h2-3H,1H3
InChIKeyHIVKSBAFBWDFFX-UHFFFAOYSA-N
MW206.03 g/mol
LogP1.92
Rot. Bonds1

About N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride

N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride (PubChem CID 165437940) has the molecular formula C6H5Cl2N3O and a molecular weight of 206.03 g/mol. Its IUPAC name is N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride.

Molecular Properties

Compound NameN-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride
PubChem CID165437940
Molecular FormulaC6H5Cl2N3O
Molecular Weight206.03 g/mol
Exact Mass204.98
IUPAC NameN-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride
SMILESCN(C(=O)Cl)c1ncc(Cl)cn1
InChIInChI=1S/C6H5Cl2N3O/c1-11(5(8)12)6-9-2-4(7)3-10-6/h2-3H,1H3
InChIKeyHIVKSBAFBWDFFX-UHFFFAOYSA-N
XLogP1.92
TPSA46.09 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.03
LogP ≤ 51.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride?
The IUPAC name of N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride (CID 165437940) is N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride.
What is the SMILES notation for N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride?
The canonical SMILES for N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride is CN(C(=O)Cl)c1ncc(Cl)cn1.
What is the InChIKey of N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride?
The InChIKey is HIVKSBAFBWDFFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2N3O/c1-11(5(8)12)6-9-2-4(7)3-10-6/h2-3H,1H3.
What are the key properties of N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride?
N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride has a molecular weight of 206.03 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloropyrimidin-2-yl)-N-methylcarbamoyl chloride is sourced from PubChem (CID 165437940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).