C12H23NO2 — CID 165438987
N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]cyclohexanamine (PubChem CID 165438987) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]cyclohexanamine.
| Compound Name | N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]cyclohexanamine |
|---|---|
| PubChem CID | 165438987 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]cyclohexanamine |
| SMILES | CC1(CCNC2CCCCC2)OCCO1 |
| InChI | InChI=1S/C12H23NO2/c1-12(14-9-10-15-12)7-8-13-11-5-3-2-4-6-11/h11,13H,2-10H2,1H3 |
| InChIKey | RBSLVJDIFRHZBS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |