C12H21NO3 — CID 165439863
1-[(3aS,6aR)-3a-(hydroxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-3-methoxypropan-1-one (PubChem CID 165439863) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 1-[(3aS,6aR)-3a-(hydroxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-3-methoxypropan-1-one.
| Compound Name | 1-[(3aS,6aR)-3a-(hydroxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-3-methoxypropan-1-one |
|---|---|
| PubChem CID | 165439863 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1-[(3aS,6aR)-3a-(hydroxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-3-methoxypropan-1-one |
| SMILES | COCCC(=O)N1CC[C@@]2(CO)CCC[C@@H]12 |
| InChI | InChI=1S/C12H21NO3/c1-16-8-4-11(15)13-7-6-12(9-14)5-2-3-10(12)13/h10,14H,2-9H2,1H3/t10-,12-/m1/s1 |
| InChIKey | SNLLWNURTWPYMD-ZYHUDNBSSA-N |
| XLogP | 0.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |