About 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one
6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one (PubChem CID 165440929) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one.
Molecular Properties
| Compound Name | 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one |
| PubChem CID | 165440929 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one |
| SMILES | Cc1c(CN)ccc2c1NC(=O)C2(C)C |
| InChI | InChI=1S/C12H16N2O/c1-7-8(6-13)4-5-9-10(7)14-11(15)12(9,2)3/h4-5H,6,13H2,1-3H3,(H,14,15) |
| InChIKey | NRMVKEYMOMOCAP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one?
The IUPAC name of 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one (CID 165440929) is 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one.
What is the SMILES notation for 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one?
The canonical SMILES for 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one is Cc1c(CN)ccc2c1NC(=O)C2(C)C.
What is the InChIKey of 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one?
The InChIKey is NRMVKEYMOMOCAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-7-8(6-13)4-5-9-10(7)14-11(15)12(9,2)3/h4-5H,6,13H2,1-3H3,(H,14,15).
What are the key properties of 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one?
6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one has a molecular weight of 204.27 g/mol, XLogP of 1.68, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-3,3,7-trimethyl-1H-indol-2-one is sourced from PubChem (CID 165440929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).