About 1,4-dibromo-3,8-dimethylisoquinoline
1,4-dibromo-3,8-dimethylisoquinoline (PubChem CID 165441244) has the molecular formula C11H9Br2N
and a molecular weight of 315.01 g/mol. Its IUPAC name is 1,4-dibromo-3,8-dimethylisoquinoline.
Molecular Properties
| Compound Name | 1,4-dibromo-3,8-dimethylisoquinoline |
| PubChem CID | 165441244 |
| Molecular Formula | C11H9Br2N |
| Molecular Weight | 315.01 g/mol |
| Exact Mass | 312.91 |
| IUPAC Name | 1,4-dibromo-3,8-dimethylisoquinoline |
| SMILES | Cc1nc(Br)c2c(C)cccc2c1Br |
| InChI | InChI=1S/C11H9Br2N/c1-6-4-3-5-8-9(6)11(13)14-7(2)10(8)12/h3-5H,1-2H3 |
| InChIKey | UWHFYUGKXMMHNX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.01 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibromo-3,8-dimethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibromo-3,8-dimethylisoquinoline?
The IUPAC name of 1,4-dibromo-3,8-dimethylisoquinoline (CID 165441244) is 1,4-dibromo-3,8-dimethylisoquinoline.
What is the SMILES notation for 1,4-dibromo-3,8-dimethylisoquinoline?
The canonical SMILES for 1,4-dibromo-3,8-dimethylisoquinoline is Cc1nc(Br)c2c(C)cccc2c1Br.
What is the InChIKey of 1,4-dibromo-3,8-dimethylisoquinoline?
The InChIKey is UWHFYUGKXMMHNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Br2N/c1-6-4-3-5-8-9(6)11(13)14-7(2)10(8)12/h3-5H,1-2H3.
What are the key properties of 1,4-dibromo-3,8-dimethylisoquinoline?
1,4-dibromo-3,8-dimethylisoquinoline has a molecular weight of 315.01 g/mol, XLogP of 4.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibromo-3,8-dimethylisoquinoline is sourced from PubChem (CID 165441244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).