(2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid

C8H12O4S — CID 165441587

IUPAC(2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid
SMILESCC/C(C(=O)O)=C1\CCS(=O)(=O)C1
InChIInChI=1S/C8H12O4S/c1-2-7(8(9)10)6-3-4-13(11,12)5-6/h2-5H2,1H3,(H,9,10)/b7-6-
InChIKeyYBRPWFFDDGRFMU-SREVYHEPSA-N
MW204.25 g/mol
LogP0.60
Rot. Bonds2

About (2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid

(2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid (PubChem CID 165441587) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is (2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid.

Molecular Properties

Compound Name(2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid
PubChem CID165441587
Molecular FormulaC8H12O4S
Molecular Weight204.25 g/mol
Exact Mass204.05
IUPAC Name(2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid
SMILESCC/C(C(=O)O)=C1\CCS(=O)(=O)C1
InChIInChI=1S/C8H12O4S/c1-2-7(8(9)10)6-3-4-13(11,12)5-6/h2-5H2,1H3,(H,9,10)/b7-6-
InChIKeyYBRPWFFDDGRFMU-SREVYHEPSA-N
XLogP0.60
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.25
LogP ≤ 50.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid?
The IUPAC name of (2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid (CID 165441587) is (2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid.
What is the SMILES notation for (2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid?
The canonical SMILES for (2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid is CC/C(C(=O)O)=C1\CCS(=O)(=O)C1.
What is the InChIKey of (2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid?
The InChIKey is YBRPWFFDDGRFMU-SREVYHEPSA-N. The full InChI is InChI=1S/C8H12O4S/c1-2-7(8(9)10)6-3-4-13(11,12)5-6/h2-5H2,1H3,(H,9,10)/b7-6-.
What are the key properties of (2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid?
(2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid has a molecular weight of 204.25 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(1,1-dioxothiolan-3-ylidene)butanoic acid is sourced from PubChem (CID 165441587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).