C13H23N3O3 — CID 165441608
tert-butyl 3a-carbamoyl-2,3,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate (PubChem CID 165441608) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl 3a-carbamoyl-2,3,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 3a-carbamoyl-2,3,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 165441608 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | tert-butyl 3a-carbamoyl-2,3,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2CNCC2(C(N)=O)C1 |
| InChI | InChI=1S/C13H23N3O3/c1-12(2,3)19-11(18)16-5-4-9-6-15-7-13(9,8-16)10(14)17/h9,15H,4-8H2,1-3H3,(H2,14,17) |
| InChIKey | KHPVKEHRKLJPGI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |