C5H6IN3O — CID 165441840
3-iodo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine (PubChem CID 165441840) has the molecular formula C5H6IN3O and a molecular weight of 251.03 g/mol. Its IUPAC name is 3-iodo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine.
| Compound Name | 3-iodo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine |
|---|---|
| PubChem CID | 165441840 |
| Molecular Formula | C5H6IN3O |
| Molecular Weight | 251.03 g/mol |
| Exact Mass | 250.96 |
| IUPAC Name | 3-iodo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazine |
| SMILES | Ic1nnc2n1CCOC2 |
| InChI | InChI=1S/C5H6IN3O/c6-5-8-7-4-3-10-2-1-9(4)5/h1-3H2 |
| InChIKey | KXIFKHALZWNSPR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.03 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|