About 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid
6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid (PubChem CID 165442221) has the molecular formula C11H10O4
and a molecular weight of 206.20 g/mol. Its IUPAC name is 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid |
| PubChem CID | 165442221 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid |
| SMILES | Cc1ccc2c(c1)CC(C(=O)O)OC2=O |
| InChI | InChI=1S/C11H10O4/c1-6-2-3-8-7(4-6)5-9(10(12)13)15-11(8)14/h2-4,9H,5H2,1H3,(H,12,13) |
| InChIKey | KIKAXBNYJWCPRR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid?
The IUPAC name of 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid (CID 165442221) is 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid.
What is the SMILES notation for 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid?
The canonical SMILES for 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid is Cc1ccc2c(c1)CC(C(=O)O)OC2=O.
What is the InChIKey of 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid?
The InChIKey is KIKAXBNYJWCPRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O4/c1-6-2-3-8-7(4-6)5-9(10(12)13)15-11(8)14/h2-4,9H,5H2,1H3,(H,12,13).
What are the key properties of 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid?
6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid has a molecular weight of 206.20 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1-oxo-3,4-dihydroisochromene-3-carboxylic acid is sourced from PubChem (CID 165442221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).