About [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate
[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate (PubChem CID 16544227) has the molecular formula C20H16Cl3N3O4
and a molecular weight of 468.72 g/mol. Its IUPAC name is [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate.
Molecular Properties
| Compound Name | [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate |
| PubChem CID | 16544227 |
| Molecular Formula | C20H16Cl3N3O4 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OCC(=O)OC(C)C(=O)Nc3ccc(Cl)cn3)c2n1 |
| InChI | InChI=1S/C20H16Cl3N3O4/c1-10-3-5-13-14(22)7-15(23)19(18(13)25-10)29-9-17(27)30-11(2)20(28)26-16-6-4-12(21)8-24-16/h3-8,11H,9H2,1-2H3,(H,24,26,28) |
| InChIKey | LNBBRXMWOHUPES-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate?
The IUPAC name of [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate (CID 16544227) is [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate.
What is the SMILES notation for [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate?
The canonical SMILES for [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate is Cc1ccc2c(Cl)cc(Cl)c(OCC(=O)OC(C)C(=O)Nc3ccc(Cl)cn3)c2n1.
What is the InChIKey of [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate?
The InChIKey is LNBBRXMWOHUPES-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16Cl3N3O4/c1-10-3-5-13-14(22)7-15(23)19(18(13)25-10)29-9-17(27)30-11(2)20(28)26-16-6-4-12(21)8-24-16/h3-8,11H,9H2,1-2H3,(H,24,26,28).
What are the key properties of [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate?
[1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate has a molecular weight of 468.72 g/mol, XLogP of 4.85, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5-chloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetate is sourced from PubChem (CID 16544227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).