About 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one
4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one (PubChem CID 165442299) has the molecular formula C9H17NO2S
and a molecular weight of 203.31 g/mol. Its IUPAC name is 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one |
| PubChem CID | 165442299 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one |
| SMILES | CS(C)(=O)=NCC1CCC(=O)CC1 |
| InChI | InChI=1S/C9H17NO2S/c1-13(2,12)10-7-8-3-5-9(11)6-4-8/h8H,3-7H2,1-2H3 |
| InChIKey | YTCXQXUHEJSXAO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one?
The IUPAC name of 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one (CID 165442299) is 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one.
What is the SMILES notation for 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one?
The canonical SMILES for 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one is CS(C)(=O)=NCC1CCC(=O)CC1.
What is the InChIKey of 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one?
The InChIKey is YTCXQXUHEJSXAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2S/c1-13(2,12)10-7-8-3-5-9(11)6-4-8/h8H,3-7H2,1-2H3.
What are the key properties of 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one?
4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one has a molecular weight of 203.31 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[dimethyl(oxo)-λ6-sulfanylidene]amino]methyl]cyclohexan-1-one is sourced from PubChem (CID 165442299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).