About [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol
[1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol (PubChem CID 165443274) has the molecular formula C8H11BrN2OS
and a molecular weight of 263.16 g/mol. Its IUPAC name is [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol |
| PubChem CID | 165443274 |
| Molecular Formula | C8H11BrN2OS |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol |
| SMILES | NCC1(C(O)c2sncc2Br)CC1 |
| InChI | InChI=1S/C8H11BrN2OS/c9-5-3-11-13-6(5)7(12)8(4-10)1-2-8/h3,7,12H,1-2,4,10H2 |
| InChIKey | LONXIJTYZAQBPO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol?
The IUPAC name of [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol (CID 165443274) is [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol.
What is the SMILES notation for [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol?
The canonical SMILES for [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol is NCC1(C(O)c2sncc2Br)CC1.
What is the InChIKey of [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol?
The InChIKey is LONXIJTYZAQBPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN2OS/c9-5-3-11-13-6(5)7(12)8(4-10)1-2-8/h3,7,12H,1-2,4,10H2.
What are the key properties of [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol?
[1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol has a molecular weight of 263.16 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(aminomethyl)cyclopropyl]-(4-bromo-1,2-thiazol-5-yl)methanol is sourced from PubChem (CID 165443274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).