About [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine
[5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine (PubChem CID 165443789) has the molecular formula C9H15F3N4
and a molecular weight of 236.24 g/mol. Its IUPAC name is [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine |
| PubChem CID | 165443789 |
| Molecular Formula | C9H15F3N4 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine |
| SMILES | CC(C)c1c(CN)nnn1C(C)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N4/c1-5(2)8-7(4-13)14-15-16(8)6(3)9(10,11)12/h5-6H,4,13H2,1-3H3 |
| InChIKey | DPWHFMUBGWVVPX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine?
The IUPAC name of [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine (CID 165443789) is [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine.
What is the SMILES notation for [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine?
The canonical SMILES for [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine is CC(C)c1c(CN)nnn1C(C)C(F)(F)F.
What is the InChIKey of [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine?
The InChIKey is DPWHFMUBGWVVPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N4/c1-5(2)8-7(4-13)14-15-16(8)6(3)9(10,11)12/h5-6H,4,13H2,1-3H3.
What are the key properties of [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine?
[5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine has a molecular weight of 236.24 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-propan-2-yl-1-(1,1,1-trifluoropropan-2-yl)triazol-4-yl]methanamine is sourced from PubChem (CID 165443789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).