C12H20O — CID 165444342
trans-(1R,2S)-1-methyl-2-pent-4-ynylcyclohexan-1-ol (PubChem CID 165444342) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is trans-(1R,2S)-1-methyl-2-pent-4-ynylcyclohexan-1-ol.
| Compound Name | trans-(1R,2S)-1-methyl-2-pent-4-ynylcyclohexan-1-ol |
|---|---|
| PubChem CID | 165444342 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | trans-(1R,2S)-1-methyl-2-pent-4-ynylcyclohexan-1-ol |
| SMILES | C#CCCC[C@@H]1CCCC[C@@]1(C)O |
| InChI | InChI=1S/C12H20O/c1-3-4-5-8-11-9-6-7-10-12(11,2)13/h1,11,13H,4-10H2,2H3/t11-,12-/m1/s1 |
| InChIKey | JOIZBMYJLLFFLD-VXGBXAGGSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|